C17H19BrO5 — CID 135067718
trans-dimethyl (3S,4S)-3-(2-bromobenzoyl)-4-methylcyclopentane-1,1-dicarboxylate (PubChem CID 135067718) has the molecular formula C17H19BrO5 and a molecular weight of 383.24 g/mol. Its IUPAC name is trans-dimethyl (3S,4S)-3-(2-bromobenzoyl)-4-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4S)-3-(2-bromobenzoyl)-4-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135067718 |
| Molecular Formula | C17H19BrO5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | trans-dimethyl (3S,4S)-3-(2-bromobenzoyl)-4-methylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H](C(=O)c2ccccc2Br)[C@@H](C)C1 |
| InChI | InChI=1S/C17H19BrO5/c1-10-8-17(15(20)22-2,16(21)23-3)9-12(10)14(19)11-6-4-5-7-13(11)18/h4-7,10,12H,8-9H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | QGJKRJUVQRXCNU-JQWIXIFHSA-N |
| XLogP | 3.01 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|