C21H25NO7 — CID 177443094
diethyl 3-oxo-4-[(3E)-2-oxo-3-phenylmethoxyiminopropyl]cyclopentane-1,1-dicarboxylate (PubChem CID 177443094) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is diethyl 3-oxo-4-[(3E)-2-oxo-3-phenylmethoxyiminopropyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-oxo-4-[(3E)-2-oxo-3-phenylmethoxyiminopropyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177443094 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | diethyl 3-oxo-4-[(3E)-2-oxo-3-phenylmethoxyiminopropyl]cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(=O)C(CC(=O)/C=N/OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H25NO7/c1-3-27-19(25)21(20(26)28-4-2)11-16(18(24)12-21)10-17(23)13-22-29-14-15-8-6-5-7-9-15/h5-9,13,16H,3-4,10-12,14H2,1-2H3/b22-13+ |
| InChIKey | UHVXTORSRBSMQV-LPYMAVHISA-N |
| XLogP | 2.24 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|