C21H30O5Si — CID 102193466
diethyl (4E)-3-hydroxy-3-phenyl-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 102193466) has the molecular formula C21H30O5Si and a molecular weight of 390.55 g/mol. Its IUPAC name is diethyl (4E)-3-hydroxy-3-phenyl-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (4E)-3-hydroxy-3-phenyl-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102193466 |
| Molecular Formula | C21H30O5Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | diethyl (4E)-3-hydroxy-3-phenyl-4-(trimethylsilylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C/C(=C\[Si](C)(C)C)C(O)(c2ccccc2)C1 |
| InChI | InChI=1S/C21H30O5Si/c1-6-25-18(22)20(19(23)26-7-2)13-17(14-27(3,4)5)21(24,15-20)16-11-9-8-10-12-16/h8-12,14,24H,6-7,13,15H2,1-5H3/b17-14+ |
| InChIKey | PWCOGNYAPYOMJD-SAPNQHFASA-N |
| XLogP | 3.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|