About ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate
ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate (PubChem CID 102046505) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate |
| PubChem CID | 102046505 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)Cc2ccccc2CO1 |
| InChI | InChI=1S/C18H18O3/c1-2-20-17(19)18(16-10-4-3-5-11-16)12-14-8-6-7-9-15(14)13-21-18/h3-11H,2,12-13H2,1H3 |
| InChIKey | UPAAACYVALMMIS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate?
The IUPAC name of ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate (CID 102046505) is ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate.
What is the SMILES notation for ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate?
The canonical SMILES for ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate is CCOC(=O)C1(c2ccccc2)Cc2ccccc2CO1.
What is the InChIKey of ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate?
The InChIKey is UPAAACYVALMMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c1-2-20-17(19)18(16-10-4-3-5-11-16)12-14-8-6-7-9-15(14)13-21-18/h3-11H,2,12-13H2,1H3.
What are the key properties of ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate?
ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate has a molecular weight of 282.34 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-phenyl-1,4-dihydroisochromene-3-carboxylate is sourced from PubChem (CID 102046505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).