C9H13Cl3O2 — CID 57155579
1-chloro-3-(2,2-dichloropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 57155579) has the molecular formula C9H13Cl3O2 and a molecular weight of 259.56 g/mol. Its IUPAC name is 1-chloro-3-(2,2-dichloropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 1-chloro-3-(2,2-dichloropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 57155579 |
| Molecular Formula | C9H13Cl3O2 |
| Molecular Weight | 259.56 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 1-chloro-3-(2,2-dichloropropyl)-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC(Cl)(Cl)CC1C(C)(C)C1(Cl)C(=O)O |
| InChI | InChI=1S/C9H13Cl3O2/c1-7(2)5(4-8(3,10)11)9(7,12)6(13)14/h5H,4H2,1-3H3,(H,13,14) |
| InChIKey | NNQCHLGMGSQGPO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|