C8H12Br2O2 — CID 12748176
3-(2,2-dibromo-3,3-dimethylcyclopropyl)propanoic acid (PubChem CID 12748176) has the molecular formula C8H12Br2O2 and a molecular weight of 299.99 g/mol. Its IUPAC name is 3-(2,2-dibromo-3,3-dimethylcyclopropyl)propanoic acid.
| Compound Name | 3-(2,2-dibromo-3,3-dimethylcyclopropyl)propanoic acid |
|---|---|
| PubChem CID | 12748176 |
| Molecular Formula | C8H12Br2O2 |
| Molecular Weight | 299.99 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 3-(2,2-dibromo-3,3-dimethylcyclopropyl)propanoic acid |
| SMILES | CC1(C)C(CCC(=O)O)C1(Br)Br |
| InChI | InChI=1S/C8H12Br2O2/c1-7(2)5(8(7,9)10)3-4-6(11)12/h5H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | TXNVMIHCCLLBET-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.99 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|