C8H12O6 — CID 42640490
3-(1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)propanoic acid (PubChem CID 42640490) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is 3-(1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)propanoic acid.
| Compound Name | 3-(1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)propanoic acid |
|---|---|
| PubChem CID | 42640490 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 3-(1,4-dimethyl-2,3,5,6-tetraoxabicyclo[2.2.1]heptan-7-yl)propanoic acid |
| SMILES | CC12OOC(C)(OO1)C2CCC(=O)O |
| InChI | InChI=1S/C8H12O6/c1-7-5(3-4-6(9)10)8(2,13-11-7)14-12-7/h5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | WXELNMMAWLJWRC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|