About 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid
3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid (PubChem CID 23594724) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid.
Analyze 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid?
The IUPAC name of 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid (CID 23594724) is 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid.
What is the SMILES notation for 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid?
The canonical SMILES for 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid is CN1C(CCC(=O)O)COC1(C)C.
What is the InChIKey of 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid?
The InChIKey is ZLRGPFPXARMXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-9(2)10(3)7(6-13-9)4-5-8(11)12/h7H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid?
3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid has a molecular weight of 187.24 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid is sourced from PubChem (CID 23594724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).