3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid

C10H17NO4 — CID 115060552

IUPAC3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid
SMILESCCCN1C(=O)COCC1CCC(=O)O
InChIInChI=1S/C10H17NO4/c1-2-5-11-8(3-4-10(13)14)6-15-7-9(11)12/h8H,2-7H2,1H3,(H,13,14)
InChIKeyWSOVAEGVEONCLE-UHFFFAOYSA-N
MW215.25 g/mol
LogP0.49
Rot. Bonds5

About 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid

3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid (PubChem CID 115060552) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid
PubChem CID115060552
Molecular FormulaC10H17NO4
Molecular Weight215.25 g/mol
Exact Mass215.12
IUPAC Name3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid
SMILESCCCN1C(=O)COCC1CCC(=O)O
InChIInChI=1S/C10H17NO4/c1-2-5-11-8(3-4-10(13)14)6-15-7-9(11)12/h8H,2-7H2,1H3,(H,13,14)
InChIKeyWSOVAEGVEONCLE-UHFFFAOYSA-N
XLogP0.49
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 50.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(4-tert-butyl-5-oxomorpholin-3-yl)propanoic acid
CID 115060537
3-[4-[(2-methylphenyl)methyl]-5-oxomorpholin-3-yl]propanoic acid
CID 115060609
3-[5-oxo-4-(pyridin-4-ylmethyl)morpholin-3-yl]propanoic acid
CID 117009713
3-(4-cyclopropyl-5-oxomorpholin-3-yl)propanoic acid
CID 115060435
3-[4-[(2-chlorophenyl)methyl]-5-oxomorpholin-3-yl]propanoic acid
CID 115060611
3-[4-(2-hydroxyphenyl)-5-oxomorpholin-3-yl]propanoic acid
CID 115060501
3-(4-butylmorpholin-3-yl)propanoic acid
CID 117009382
4-[(1-methylpiperidin-4-yl)methyl]-5-oxomorpholine-3-carboxylic acid
CID 115102644
3-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)propanoic acid
CID 23594724
3-(4-tert-butylmorpholin-3-yl)propanoic acid
CID 117009398
3-[4-(2-methoxyethyl)morpholin-3-yl]propanoic acid
CID 117009385
5-(hydroxymethyl)-4-[(1-methylpiperidin-4-yl)methyl]morpholin-3-one
CID 115102637

Frequently Asked Questions

What is the IUPAC name of 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid?
The IUPAC name of 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid (CID 115060552) is 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid.
What is the SMILES notation for 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid?
The canonical SMILES for 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid is CCCN1C(=O)COCC1CCC(=O)O.
What is the InChIKey of 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid?
The InChIKey is WSOVAEGVEONCLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-2-5-11-8(3-4-10(13)14)6-15-7-9(11)12/h8H,2-7H2,1H3,(H,13,14).
What are the key properties of 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid?
3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid has a molecular weight of 215.25 g/mol, XLogP of 0.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-oxo-4-propylmorpholin-3-yl)propanoic acid is sourced from PubChem (CID 115060552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).