C9H18BNO — CID 145480682
CID 145480682 (PubChem CID 145480682) has the molecular formula C9H18BNO and a molecular weight of 167.06 g/mol.
| Compound Name | CID 145480682 |
|---|---|
| PubChem CID | 145480682 |
| Molecular Formula | C9H18BNO |
| Molecular Weight | 167.06 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | — |
| SMILES | [B]CCCC1COC(C)(C)N1C |
| InChI | InChI=1S/C9H18BNO/c1-9(2)11(3)8(7-12-9)5-4-6-10/h8H,4-7H2,1-3H3 |
| InChIKey | DNZNIZPDYUKHTG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.06 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|