C11H24BNO — CID 145480681
CID 145480681 (PubChem CID 145480681) has the molecular formula C11H24BNO and a molecular weight of 197.13 g/mol.
| Compound Name | CID 145480681 |
|---|---|
| PubChem CID | 145480681 |
| Molecular Formula | C11H24BNO |
| Molecular Weight | 197.13 g/mol |
| Exact Mass | 197.20 |
| IUPAC Name | — |
| SMILES | CC.[B]CCCC1COC(C)(C)N1C |
| InChI | InChI=1S/C9H18BNO.C2H6/c1-9(2)11(3)8(7-12-9)5-4-6-10;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | CLOGRJYTRAZVAI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.13 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|