C11H14ClFO3 — CID 15017051
ethyl (E)-3-[(1S,3R)-3-carbonochloridoyl-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate (PubChem CID 15017051) has the molecular formula C11H14ClFO3 and a molecular weight of 248.68 g/mol. Its IUPAC name is ethyl (E)-3-[(1S,3R)-3-carbonochloridoyl-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S,3R)-3-carbonochloridoyl-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate |
|---|---|
| PubChem CID | 15017051 |
| Molecular Formula | C11H14ClFO3 |
| Molecular Weight | 248.68 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | ethyl (E)-3-[(1S,3R)-3-carbonochloridoyl-2,2-dimethylcyclopropyl]-2-fluoroprop-2-enoate |
| SMILES | CCOC(=O)/C(F)=C\[C@H]1[C@@H](C(=O)Cl)C1(C)C |
| InChI | InChI=1S/C11H14ClFO3/c1-4-16-10(15)7(13)5-6-8(9(12)14)11(6,2)3/h5-6,8H,4H2,1-3H3/b7-5+/t6-,8-/m0/s1 |
| InChIKey | ZKRMSPZTQLLZLG-MMIQFEHNSA-N |
| XLogP | 2.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|