C11H14ClO4- — CID 19907288
3-[(E)-2-chloro-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 19907288) has the molecular formula C11H14ClO4- and a molecular weight of 245.68 g/mol. Its IUPAC name is 3-[(E)-2-chloro-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | 3-[(E)-2-chloro-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 19907288 |
| Molecular Formula | C11H14ClO4- |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-[(E)-2-chloro-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)/C(Cl)=C\C1C(C(=O)[O-])C1(C)C |
| InChI | InChI=1S/C11H15ClO4/c1-4-16-10(15)7(12)5-6-8(9(13)14)11(6,2)3/h5-6,8H,4H2,1-3H3,(H,13,14)/p-1/b7-5+ |
| InChIKey | OBFQPJFNNVALEC-FNORWQNLSA-M |
| XLogP | 0.69 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|