C11H19NO3 — CID 144594097
spiro[3,4,4a,5,7,7a-hexahydrofuro[3,4-b]pyran-2,2'-oxolane]-5-ylmethanamine (PubChem CID 144594097) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is spiro[3,4,4a,5,7,7a-hexahydrofuro[3,4-b]pyran-2,2'-oxolane]-5-ylmethanamine.
| Compound Name | spiro[3,4,4a,5,7,7a-hexahydrofuro[3,4-b]pyran-2,2'-oxolane]-5-ylmethanamine |
|---|---|
| PubChem CID | 144594097 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | spiro[3,4,4a,5,7,7a-hexahydrofuro[3,4-b]pyran-2,2'-oxolane]-5-ylmethanamine |
| SMILES | NCC1OCC2OC3(CCCO3)CCC12 |
| InChI | InChI=1S/C11H19NO3/c12-6-9-8-2-4-11(3-1-5-14-11)15-10(8)7-13-9/h8-10H,1-7,12H2 |
| InChIKey | PLBKFBINDLACRL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |