C22H36O4 — CID 10522810
ethyl (2Z)-6-methyl-2-[3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propylidene]hept-5-enoate (PubChem CID 10522810) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is ethyl (2Z)-6-methyl-2-[3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propylidene]hept-5-enoate.
| Compound Name | ethyl (2Z)-6-methyl-2-[3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propylidene]hept-5-enoate |
|---|---|
| PubChem CID | 10522810 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | ethyl (2Z)-6-methyl-2-[3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propylidene]hept-5-enoate |
| SMILES | CCOC(=O)/C(=C\CCC1(C)CCCC2(C1)OCCO2)CCC=C(C)C |
| InChI | InChI=1S/C22H36O4/c1-5-24-20(23)19(10-6-9-18(2)3)11-7-12-21(4)13-8-14-22(17-21)25-15-16-26-22/h9,11H,5-8,10,12-17H2,1-4H3/b19-11- |
| InChIKey | VIVBGVOZLNBCIX-ODLFYWEKSA-N |
| XLogP | 5.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|