C12H20O3 — CID 10632335
3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propanal (PubChem CID 10632335) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propanal.
| Compound Name | 3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propanal |
|---|---|
| PubChem CID | 10632335 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)propanal |
| SMILES | CC1(CCC=O)CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C12H20O3/c1-11(5-3-7-13)4-2-6-12(10-11)14-8-9-15-12/h7H,2-6,8-10H2,1H3 |
| InChIKey | UYRLFHHRMRKMOS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|