C10H15NO2 — CID 10654993
7-methyl-1,4-dioxaspiro[4.5]decane-7-carbonitrile (PubChem CID 10654993) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 7-methyl-1,4-dioxaspiro[4.5]decane-7-carbonitrile.
| Compound Name | 7-methyl-1,4-dioxaspiro[4.5]decane-7-carbonitrile |
|---|---|
| PubChem CID | 10654993 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 7-methyl-1,4-dioxaspiro[4.5]decane-7-carbonitrile |
| SMILES | CC1(C#N)CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C10H15NO2/c1-9(8-11)3-2-4-10(7-9)12-5-6-13-10/h2-7H2,1H3 |
| InChIKey | VQYZLQXPTANZBR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |