C9H17NO2Si — CID 91600100
4,7-dioxaspiro[2.4]heptane;trimethylsilylformonitrile (PubChem CID 91600100) has the molecular formula C9H17NO2Si and a molecular weight of 199.33 g/mol. Its IUPAC name is 4,7-dioxaspiro[2.4]heptane;trimethylsilylformonitrile.
| Compound Name | 4,7-dioxaspiro[2.4]heptane;trimethylsilylformonitrile |
|---|---|
| PubChem CID | 91600100 |
| Molecular Formula | C9H17NO2Si |
| Molecular Weight | 199.33 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4,7-dioxaspiro[2.4]heptane;trimethylsilylformonitrile |
| SMILES | C1COC2(CC2)O1.C[Si](C)(C)C#N |
| InChI | InChI=1S/C5H8O2.C4H9NSi/c1-2-5(1)6-3-4-7-5;1-6(2,3)4-5/h1-4H2;1-3H3 |
| InChIKey | HJFAISJLDJHWRI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|