C15H28O3 — CID 143931271
ethane;8-prop-1-ynyl-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 143931271) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is ethane;8-prop-1-ynyl-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | ethane;8-prop-1-ynyl-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 143931271 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | ethane;8-prop-1-ynyl-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | CC.CC.CC#CC1(O)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H16O3.2C2H6/c1-2-3-10(12)4-6-11(7-5-10)13-8-9-14-11;2*1-2/h12H,4-9H2,1H3;2*1-2H3 |
| InChIKey | BWWJWBSDPPIKSJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|