About ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol
ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 91262908) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol.
Molecular Properties
| Compound Name | ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol |
| PubChem CID | 91262908 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | CC.OC1(c2ccccc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H18O3.C2H6/c15-13(12-4-2-1-3-5-12)6-8-14(9-7-13)16-10-11-17-14;1-2/h1-5,15H,6-11H2;1-2H3 |
| InChIKey | YAVRCQKVLDIAJT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol?
The IUPAC name of ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol (CID 91262908) is ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol.
What is the SMILES notation for ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol?
The canonical SMILES for ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol is CC.OC1(c2ccccc2)CCC2(CC1)OCCO2.
What is the InChIKey of ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol?
The InChIKey is YAVRCQKVLDIAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3.C2H6/c15-13(12-4-2-1-3-5-12)6-8-14(9-7-13)16-10-11-17-14;1-2/h1-5,15H,6-11H2;1-2H3.
What are the key properties of ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol?
ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol has a molecular weight of 264.37 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-phenyl-1,4-dioxaspiro[4.5]decan-8-ol is sourced from PubChem (CID 91262908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).