C20H23NO4 — CID 59361618
8-(6-phenylmethoxy-3-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 59361618) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 8-(6-phenylmethoxy-3-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | 8-(6-phenylmethoxy-3-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 59361618 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 8-(6-phenylmethoxy-3-pyridinyl)-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | OC1(c2ccc(OCc3ccccc3)nc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C20H23NO4/c22-19(8-10-20(11-9-19)24-12-13-25-20)17-6-7-18(21-14-17)23-15-16-4-2-1-3-5-16/h1-7,14,22H,8-13,15H2 |
| InChIKey | IGJLCXDQVVZPJN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |