C16H22O4 — CID 156775345
7-[2-(2-hydroxyethyl)phenyl]-1,4-dioxaspiro[4.5]decan-7-ol (PubChem CID 156775345) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 7-[2-(2-hydroxyethyl)phenyl]-1,4-dioxaspiro[4.5]decan-7-ol.
| Compound Name | 7-[2-(2-hydroxyethyl)phenyl]-1,4-dioxaspiro[4.5]decan-7-ol |
|---|---|
| PubChem CID | 156775345 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 7-[2-(2-hydroxyethyl)phenyl]-1,4-dioxaspiro[4.5]decan-7-ol |
| SMILES | OCCc1ccccc1C1(O)CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C16H22O4/c17-9-6-13-4-1-2-5-14(13)15(18)7-3-8-16(12-15)19-10-11-20-16/h1-2,4-5,17-18H,3,6-12H2 |
| InChIKey | ZYNDWYRCDAZSNS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |