C12H18O2 — CID 118423720
8-cyclobutylidene-1,4-dioxaspiro[4.5]decane (PubChem CID 118423720) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 8-cyclobutylidene-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-cyclobutylidene-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 118423720 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 8-cyclobutylidene-1,4-dioxaspiro[4.5]decane |
| SMILES | C1CC(=C2CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C12H18O2/c1-2-10(3-1)11-4-6-12(7-5-11)13-8-9-14-12/h1-9H2 |
| InChIKey | UFHPTVBCIXLLKR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|