C9H19NO — CID 171091773
ethane;1,4,4-trimethylpyrrolidin-2-one (PubChem CID 171091773) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is ethane;1,4,4-trimethylpyrrolidin-2-one.
| Compound Name | ethane;1,4,4-trimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 171091773 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | ethane;1,4,4-trimethylpyrrolidin-2-one |
| SMILES | CC.CN1CC(C)(C)CC1=O |
| InChI | InChI=1S/C7H13NO.C2H6/c1-7(2)4-6(9)8(3)5-7;1-2/h4-5H2,1-3H3;1-2H3 |
| InChIKey | PVSMDAWGMVXYSQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |