C10H21NO — CID 143025002
ethane;1,4,4-trimethylpiperidin-2-one (PubChem CID 143025002) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is ethane;1,4,4-trimethylpiperidin-2-one.
| Compound Name | ethane;1,4,4-trimethylpiperidin-2-one |
|---|---|
| PubChem CID | 143025002 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | ethane;1,4,4-trimethylpiperidin-2-one |
| SMILES | CC.CN1CCC(C)(C)CC1=O |
| InChI | InChI=1S/C8H15NO.C2H6/c1-8(2)4-5-9(3)7(10)6-8;1-2/h4-6H2,1-3H3;1-2H3 |
| InChIKey | NCXQDVKLCFSMSU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |