C9H16N2O2 — CID 91304398
2,9-dimethyl-6-oxa-2,9-diazaspiro[4.5]decan-3-one (PubChem CID 91304398) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2,9-dimethyl-6-oxa-2,9-diazaspiro[4.5]decan-3-one.
| Compound Name | 2,9-dimethyl-6-oxa-2,9-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 91304398 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2,9-dimethyl-6-oxa-2,9-diazaspiro[4.5]decan-3-one |
| SMILES | CN1CCOC2(CC(=O)N(C)C2)C1 |
| InChI | InChI=1S/C9H16N2O2/c1-10-3-4-13-9(6-10)5-8(12)11(2)7-9/h3-7H2,1-2H3 |
| InChIKey | BDBXFHYXEZBUOB-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |