C16H24N2O2 — CID 82626405
7,9-dimethoxy-1-methylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine] (PubChem CID 82626405) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 7,9-dimethoxy-1-methylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine].
| Compound Name | 7,9-dimethoxy-1-methylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine] |
|---|---|
| PubChem CID | 82626405 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 7,9-dimethoxy-1-methylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine] |
| SMILES | COc1cc2c(c(OC)c1)N(C)CCC1(CCNC1)C2 |
| InChI | InChI=1S/C16H24N2O2/c1-18-7-5-16(4-6-17-11-16)10-12-8-13(19-2)9-14(20-3)15(12)18/h8-9,17H,4-7,10-11H2,1-3H3 |
| InChIKey | LAGXEKDTOKBNEQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|