C11H20N2S — CID 123444058
2,8-diazaspiro[4.5]decan-8-yl-ethenylidene-methyl-λ4-sulfane (PubChem CID 123444058) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 2,8-diazaspiro[4.5]decan-8-yl-ethenylidene-methyl-λ4-sulfane.
| Compound Name | 2,8-diazaspiro[4.5]decan-8-yl-ethenylidene-methyl-λ4-sulfane |
|---|---|
| PubChem CID | 123444058 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2,8-diazaspiro[4.5]decan-8-yl-ethenylidene-methyl-λ4-sulfane |
| SMILES | C=C=S(C)N1CCC2(CCNC2)CC1 |
| InChI | InChI=1S/C11H20N2S/c1-3-14(2)13-8-5-11(6-9-13)4-7-12-10-11/h12H,1,4-10H2,2H3 |
| InChIKey | FXPDSDRFPGIDOB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|