About 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane
2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane (PubChem CID 120907644) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 120907644 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane |
| SMILES | CCC(CC)(CC)CN1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C15H30N2/c1-4-14(5-2,6-3)12-17-10-8-15(13-17)7-9-16-11-15/h16H,4-13H2,1-3H3 |
| InChIKey | RWQWTFCJNUUWKU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane (CID 120907644) is 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane is CCC(CC)(CC)CN1CCC2(CCNC2)C1.
What is the InChIKey of 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane?
The InChIKey is RWQWTFCJNUUWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2/c1-4-14(5-2,6-3)12-17-10-8-15(13-17)7-9-16-11-15/h16H,4-13H2,1-3H3.
What are the key properties of 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane?
2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane has a molecular weight of 238.42 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethylbutyl)-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 120907644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).