C11H25NO — CID 142009512
ethane;1-(2-methoxyethyl)-3,3-dimethylpyrrolidine (PubChem CID 142009512) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is ethane;1-(2-methoxyethyl)-3,3-dimethylpyrrolidine.
| Compound Name | ethane;1-(2-methoxyethyl)-3,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 142009512 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | ethane;1-(2-methoxyethyl)-3,3-dimethylpyrrolidine |
| SMILES | CC.COCCN1CCC(C)(C)C1 |
| InChI | InChI=1S/C9H19NO.C2H6/c1-9(2)4-5-10(8-9)6-7-11-3;1-2/h4-8H2,1-3H3;1-2H3 |
| InChIKey | NSBIPHQOERDUFT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |