C8H16ClN — CID 18182640
1-(2-chloroethyl)-3,3-dimethylpyrrolidine (PubChem CID 18182640) has the molecular formula C8H16ClN and a molecular weight of 161.68 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3,3-dimethylpyrrolidine.
| Compound Name | 1-(2-chloroethyl)-3,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 18182640 |
| Molecular Formula | C8H16ClN |
| Molecular Weight | 161.68 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1-(2-chloroethyl)-3,3-dimethylpyrrolidine |
| SMILES | CC1(C)CCN(CCCl)C1 |
| InChI | InChI=1S/C8H16ClN/c1-8(2)3-5-10(7-8)6-4-9/h3-7H2,1-2H3 |
| InChIKey | VZKAAJDTNSUHTM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|