C9H19NO2S — CID 126539787
3,3-dimethyl-1-(2-methylsulfonylethyl)pyrrolidine (PubChem CID 126539787) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methylsulfonylethyl)pyrrolidine.
| Compound Name | 3,3-dimethyl-1-(2-methylsulfonylethyl)pyrrolidine |
|---|---|
| PubChem CID | 126539787 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3,3-dimethyl-1-(2-methylsulfonylethyl)pyrrolidine |
| SMILES | CC1(C)CCN(CCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C9H19NO2S/c1-9(2)4-5-10(8-9)6-7-13(3,11)12/h4-8H2,1-3H3 |
| InChIKey | XMCLLOGMPSTCKE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |