C13H28F3N — CID 144979676
3,3-dimethyl-1-(3,3,3-trifluoropropyl)pyrrolidine;ethane (PubChem CID 144979676) has the molecular formula C13H28F3N and a molecular weight of 255.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3,3,3-trifluoropropyl)pyrrolidine;ethane.
| Compound Name | 3,3-dimethyl-1-(3,3,3-trifluoropropyl)pyrrolidine;ethane |
|---|---|
| PubChem CID | 144979676 |
| Molecular Formula | C13H28F3N |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 3,3-dimethyl-1-(3,3,3-trifluoropropyl)pyrrolidine;ethane |
| SMILES | CC.CC.CC1(C)CCN(CCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3N.2C2H6/c1-8(2)3-5-13(7-8)6-4-9(10,11)12;2*1-2/h3-7H2,1-2H3;2*1-2H3 |
| InChIKey | RRPMIHAPZSERTP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |