C9H13F6N — CID 22253783
2,2,3,4,5,5-hexafluoro-3,4-dimethyl-1-propylpyrrolidine (PubChem CID 22253783) has the molecular formula C9H13F6N and a molecular weight of 249.20 g/mol. Its IUPAC name is 2,2,3,4,5,5-hexafluoro-3,4-dimethyl-1-propylpyrrolidine.
| Compound Name | 2,2,3,4,5,5-hexafluoro-3,4-dimethyl-1-propylpyrrolidine |
|---|---|
| PubChem CID | 22253783 |
| Molecular Formula | C9H13F6N |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2,2,3,4,5,5-hexafluoro-3,4-dimethyl-1-propylpyrrolidine |
| SMILES | CCCN1C(F)(F)C(C)(F)C(C)(F)C1(F)F |
| InChI | InChI=1S/C9H13F6N/c1-4-5-16-8(12,13)6(2,10)7(3,11)9(16,14)15/h4-5H2,1-3H3 |
| InChIKey | FJXTWECILWUOAS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|