C7H13F2N — CID 58279612
1-(2,2-difluoroethyl)-3-methylpyrrolidine (PubChem CID 58279612) has the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methylpyrrolidine.
| Compound Name | 1-(2,2-difluoroethyl)-3-methylpyrrolidine |
|---|---|
| PubChem CID | 58279612 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-methylpyrrolidine |
| SMILES | CC1CCN(CC(F)F)C1 |
| InChI | InChI=1S/C7H13F2N/c1-6-2-3-10(4-6)5-7(8)9/h6-7H,2-5H2,1H3 |
| InChIKey | QJUDTYJRZHLPFH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |