About (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride
(2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride (PubChem CID 130927327) has the molecular formula C10H20ClN3O
and a molecular weight of 233.74 g/mol. Its IUPAC name is (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride |
| PubChem CID | 130927327 |
| Molecular Formula | C10H20ClN3O |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride |
| SMILES | C[C@H](N)C(=O)N1CCC2(CCNC2)C1.Cl |
| InChI | InChI=1S/C10H19N3O.ClH/c1-8(11)9(14)13-5-3-10(7-13)2-4-12-6-10;/h8,12H,2-7,11H2,1H3;1H/t8-,10?;/m0./s1 |
| InChIKey | NAJFQNAVVZRECP-ISRZGASSSA-N |
| XLogP | -0.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride?
The IUPAC name of (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride (CID 130927327) is (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride.
What is the SMILES notation for (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride?
The canonical SMILES for (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride is C[C@H](N)C(=O)N1CCC2(CCNC2)C1.Cl.
What is the InChIKey of (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride?
The InChIKey is NAJFQNAVVZRECP-ISRZGASSSA-N. The full InChI is InChI=1S/C10H19N3O.ClH/c1-8(11)9(14)13-5-3-10(7-13)2-4-12-6-10;/h8,12H,2-7,11H2,1H3;1H/t8-,10?;/m0./s1.
What are the key properties of (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride?
(2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride has a molecular weight of 233.74 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1-(2,7-diazaspiro[4.4]nonan-2-yl)propan-1-one;hydrochloride is sourced from PubChem (CID 130927327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).