About 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole
5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole (PubChem CID 135301811) has the molecular formula C17H23N3S
and a molecular weight of 301.46 g/mol. Its IUPAC name is 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole |
| PubChem CID | 135301811 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole |
| SMILES | Cc1nc2cc(C(C)N3CCC4(CCNC4)C3)ccc2s1 |
| InChI | InChI=1S/C17H23N3S/c1-12(20-8-6-17(11-20)5-7-18-10-17)14-3-4-16-15(9-14)19-13(2)21-16/h3-4,9,12,18H,5-8,10-11H2,1-2H3 |
| InChIKey | NXHHQGPORADQNI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole?
The IUPAC name of 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole (CID 135301811) is 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole.
What is the SMILES notation for 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole?
The canonical SMILES for 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole is Cc1nc2cc(C(C)N3CCC4(CCNC4)C3)ccc2s1.
What is the InChIKey of 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole?
The InChIKey is NXHHQGPORADQNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3S/c1-12(20-8-6-17(11-20)5-7-18-10-17)14-3-4-16-15(9-14)19-13(2)21-16/h3-4,9,12,18H,5-8,10-11H2,1-2H3.
What are the key properties of 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole?
5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole has a molecular weight of 301.46 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,7-diazaspiro[4.4]nonan-2-yl)ethyl]-2-methyl-1,3-benzothiazole is sourced from PubChem (CID 135301811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).