About (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane
(5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane (PubChem CID 167531970) has the molecular formula C12H24F2N2
and a molecular weight of 234.33 g/mol. Its IUPAC name is (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane.
Molecular Properties
| Compound Name | (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane |
| PubChem CID | 167531970 |
| Molecular Formula | C12H24F2N2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane |
| SMILES | C.CC(C)N1CC[C@]2(CNCCC2(F)F)C1 |
| InChI | InChI=1S/C11H20F2N2.CH4/c1-9(2)15-6-4-10(8-15)7-14-5-3-11(10,12)13;/h9,14H,3-8H2,1-2H3;1H4/t10-;/m0./s1 |
| InChIKey | ACAKNQZFXXLLPE-PPHPATTJSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane?
The IUPAC name of (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane (CID 167531970) is (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane.
What is the SMILES notation for (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane?
The canonical SMILES for (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane is C.CC(C)N1CC[C@]2(CNCCC2(F)F)C1.
What is the InChIKey of (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane?
The InChIKey is ACAKNQZFXXLLPE-PPHPATTJSA-N. The full InChI is InChI=1S/C11H20F2N2.CH4/c1-9(2)15-6-4-10(8-15)7-14-5-3-11(10,12)13;/h9,14H,3-8H2,1-2H3;1H4/t10-;/m0./s1.
What are the key properties of (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane?
(5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane has a molecular weight of 234.33 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6,6-difluoro-2-propan-2-yl-2,9-diazaspiro[4.5]decane;methane is sourced from PubChem (CID 167531970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).