C9H16F2N2 — CID 157032814
8,8-difluoro-6-propan-2-yl-2,6-diazaspiro[3.4]octane (PubChem CID 157032814) has the molecular formula C9H16F2N2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 8,8-difluoro-6-propan-2-yl-2,6-diazaspiro[3.4]octane.
| Compound Name | 8,8-difluoro-6-propan-2-yl-2,6-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 157032814 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 8,8-difluoro-6-propan-2-yl-2,6-diazaspiro[3.4]octane |
| SMILES | CC(C)N1CC(F)(F)C2(CNC2)C1 |
| InChI | InChI=1S/C9H16F2N2/c1-7(2)13-5-8(3-12-4-8)9(10,11)6-13/h7,12H,3-6H2,1-2H3 |
| InChIKey | ITZGMIMNDUHOSN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |