About 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane
4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane (PubChem CID 139359285) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane |
| PubChem CID | 139359285 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane |
| SMILES | CC(C)N1CCNC2(CCNCC2)C1 |
| InChI | InChI=1S/C11H23N3/c1-10(2)14-8-7-13-11(9-14)3-5-12-6-4-11/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | CULUEHXJXLGMQK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane?
The IUPAC name of 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane (CID 139359285) is 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane.
What is the SMILES notation for 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane?
The canonical SMILES for 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane is CC(C)N1CCNC2(CCNCC2)C1.
What is the InChIKey of 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane?
The InChIKey is CULUEHXJXLGMQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-10(2)14-8-7-13-11(9-14)3-5-12-6-4-11/h10,12-13H,3-9H2,1-2H3.
What are the key properties of 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane?
4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane has a molecular weight of 197.33 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1,4,9-triazaspiro[5.5]undecane is sourced from PubChem (CID 139359285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).