About molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane
molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane (PubChem CID 170571753) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane.
Analyze molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane?
The IUPAC name of molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane (CID 170571753) is molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane.
What is the SMILES notation for molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane?
The canonical SMILES for molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane is CC(C)N1CCCC2(CCN2)C1.[H][H].
What is the InChIKey of molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane?
The InChIKey is PVWJXNPTWISSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.H2/c1-9(2)12-7-3-4-10(8-12)5-6-11-10;/h9,11H,3-8H2,1-2H3;1H.
What are the key properties of molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane?
molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane has a molecular weight of 170.30 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;8-propan-2-yl-1,8-diazaspiro[3.5]nonane is sourced from PubChem (CID 170571753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).