C8H16N2 — CID 155640500
6-propan-2-yl-1,6-diazaspiro[2.4]heptane (PubChem CID 155640500) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 6-propan-2-yl-1,6-diazaspiro[2.4]heptane.
| Compound Name | 6-propan-2-yl-1,6-diazaspiro[2.4]heptane |
|---|---|
| PubChem CID | 155640500 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 6-propan-2-yl-1,6-diazaspiro[2.4]heptane |
| SMILES | CC(C)N1CCC2(CN2)C1 |
| InChI | InChI=1S/C8H16N2/c1-7(2)10-4-3-8(6-10)5-9-8/h7,9H,3-6H2,1-2H3 |
| InChIKey | NMILGVRPGSXKDN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 25.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|