C10H21N3 — CID 167290889
4-ethyl-1,4,9-triazaspiro[5.5]undecane (PubChem CID 167290889) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 4-ethyl-1,4,9-triazaspiro[5.5]undecane.
| Compound Name | 4-ethyl-1,4,9-triazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 167290889 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 4-ethyl-1,4,9-triazaspiro[5.5]undecane |
| SMILES | CCN1CCNC2(CCNCC2)C1 |
| InChI | InChI=1S/C10H21N3/c1-2-13-8-7-12-10(9-13)3-5-11-6-4-10/h11-12H,2-9H2,1H3 |
| InChIKey | IOUJIGZGIUWABI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |