ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen

C10H24N2 — CID 143973878

IUPACethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen
SMILESCC.CCN1CCC2(CCN2)C1.[H][H]
InChIInChI=1S/C8H16N2.C2H6.H2/c1-2-10-6-4-8(7-10)3-5-9-8;1-2;/h9H,2-7H2,1H3;1-2H3;1H
InChIKeyHPDCUAKKKVMYLY-UHFFFAOYSA-N
MW172.32 g/mol
LogP1.72
Rot. Bonds1

About ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen

ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen (PubChem CID 143973878) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen.

Molecular Properties

Compound Nameethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen
PubChem CID143973878
Molecular FormulaC10H24N2
Molecular Weight172.32 g/mol
Exact Mass172.19
IUPAC Nameethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen
SMILESCC.CCN1CCC2(CCN2)C1.[H][H]
InChIInChI=1S/C8H16N2.C2H6.H2/c1-2-10-6-4-8(7-10)3-5-9-8;1-2;/h9H,2-7H2,1H3;1-2H3;1H
InChIKeyHPDCUAKKKVMYLY-UHFFFAOYSA-N
XLogP1.72
TPSA15.27 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.32
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen?
The IUPAC name of ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen (CID 143973878) is ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen.
What is the SMILES notation for ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen?
The canonical SMILES for ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen is CC.CCN1CCC2(CCN2)C1.[H][H].
What is the InChIKey of ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen?
The InChIKey is HPDCUAKKKVMYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C2H6.H2/c1-2-10-6-4-8(7-10)3-5-9-8;1-2;/h9H,2-7H2,1H3;1-2H3;1H.
What are the key properties of ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen?
ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen has a molecular weight of 172.32 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethyl-1,7-diazaspiro[3.4]octane;molecular hydrogen is sourced from PubChem (CID 143973878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).