C9H18N2O — CID 129498775
(5S)-9-ethyl-2-oxa-6,9-diazaspiro[4.5]decane (PubChem CID 129498775) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (5S)-9-ethyl-2-oxa-6,9-diazaspiro[4.5]decane.
| Compound Name | (5S)-9-ethyl-2-oxa-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 129498775 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (5S)-9-ethyl-2-oxa-6,9-diazaspiro[4.5]decane |
| SMILES | CCN1CCN[C@@]2(CCOC2)C1 |
| InChI | InChI=1S/C9H18N2O/c1-2-11-5-4-10-9(7-11)3-6-12-8-9/h10H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | GURBJRKCTMCBNZ-VIFPVBQESA-N |
| XLogP | 0.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |