C12H28N2 — CID 176567452
ethane;7-ethyl-4,7-diazaspiro[2.5]octane (PubChem CID 176567452) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is ethane;7-ethyl-4,7-diazaspiro[2.5]octane.
| Compound Name | ethane;7-ethyl-4,7-diazaspiro[2.5]octane |
|---|---|
| PubChem CID | 176567452 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | ethane;7-ethyl-4,7-diazaspiro[2.5]octane |
| SMILES | CC.CC.CCN1CCNC2(CC2)C1 |
| InChI | InChI=1S/C8H16N2.2C2H6/c1-2-10-6-5-9-8(7-10)3-4-8;2*1-2/h9H,2-7H2,1H3;2*1-2H3 |
| InChIKey | HIHVNQKXZFLBIR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |