C19H38N2 — CID 64831885
4-decyl-1,4-diazaspiro[5.5]undecane (PubChem CID 64831885) has the molecular formula C19H38N2 and a molecular weight of 294.53 g/mol. Its IUPAC name is 4-decyl-1,4-diazaspiro[5.5]undecane.
| Compound Name | 4-decyl-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 64831885 |
| Molecular Formula | C19H38N2 |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.30 |
| IUPAC Name | 4-decyl-1,4-diazaspiro[5.5]undecane |
| SMILES | CCCCCCCCCCN1CCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C19H38N2/c1-2-3-4-5-6-7-8-12-16-21-17-15-20-19(18-21)13-10-9-11-14-19/h20H,2-18H2,1H3 |
| InChIKey | NJJWFURCFDMTKG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|