About 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane
9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane (PubChem CID 106458471) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane |
| PubChem CID | 106458471 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CCCOCCN1CCNC2(CCCC2)C1 |
| InChI | InChI=1S/C13H26N2O/c1-2-10-16-11-9-15-8-7-14-13(12-15)5-3-4-6-13/h14H,2-12H2,1H3 |
| InChIKey | LAWXWTZSDLDBIY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane?
The IUPAC name of 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane (CID 106458471) is 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane is CCCOCCN1CCNC2(CCCC2)C1.
What is the InChIKey of 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane?
The InChIKey is LAWXWTZSDLDBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-2-10-16-11-9-15-8-7-14-13(12-15)5-3-4-6-13/h14H,2-12H2,1H3.
What are the key properties of 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane?
9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane has a molecular weight of 226.36 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2-propoxyethyl)-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 106458471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).