C10H19NO — CID 90348092
7-propan-2-yl-2-oxa-7-azaspiro[4.4]nonane (PubChem CID 90348092) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 7-propan-2-yl-2-oxa-7-azaspiro[4.4]nonane.
| Compound Name | 7-propan-2-yl-2-oxa-7-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 90348092 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 7-propan-2-yl-2-oxa-7-azaspiro[4.4]nonane |
| SMILES | CC(C)N1CCC2(CCOC2)C1 |
| InChI | InChI=1S/C10H19NO/c1-9(2)11-5-3-10(7-11)4-6-12-8-10/h9H,3-8H2,1-2H3 |
| InChIKey | QXPXLFVZVLFPJC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |