C9H16ClNO — CID 166849919
7-(1-chloroethyl)-2-oxa-7-azaspiro[4.4]nonane (PubChem CID 166849919) has the molecular formula C9H16ClNO and a molecular weight of 189.69 g/mol. Its IUPAC name is 7-(1-chloroethyl)-2-oxa-7-azaspiro[4.4]nonane.
| Compound Name | 7-(1-chloroethyl)-2-oxa-7-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 166849919 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 7-(1-chloroethyl)-2-oxa-7-azaspiro[4.4]nonane |
| SMILES | CC(Cl)N1CCC2(CCOC2)C1 |
| InChI | InChI=1S/C9H16ClNO/c1-8(10)11-4-2-9(6-11)3-5-12-7-9/h8H,2-7H2,1H3 |
| InChIKey | ORTLBPLOTQOWIU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|